C15H20F3N3O2 — CID 110890918
1-cyclopropyl-3-[2-(dimethylamino)-5-(trifluoromethyl)phenyl]-1-(2-hydroxyethyl)urea (PubChem CID 110890918) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(dimethylamino)-5-(trifluoromethyl)phenyl]-1-(2-hydroxyethyl)urea.
| Compound Name | 1-cyclopropyl-3-[2-(dimethylamino)-5-(trifluoromethyl)phenyl]-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110890918 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-cyclopropyl-3-[2-(dimethylamino)-5-(trifluoromethyl)phenyl]-1-(2-hydroxyethyl)urea |
| SMILES | CN(C)c1ccc(C(F)(F)F)cc1NC(=O)N(CCO)C1CC1 |
| InChI | InChI=1S/C15H20F3N3O2/c1-20(2)13-6-3-10(15(16,17)18)9-12(13)19-14(23)21(7-8-22)11-4-5-11/h3,6,9,11,22H,4-5,7-8H2,1-2H3,(H,19,23) |
| InChIKey | YEWCGPDBFBFRMA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |