C16H21F3N2O2 — CID 122029595
4-[2-(dimethylamino)-5-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid (PubChem CID 122029595) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 4-[2-(dimethylamino)-5-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-(dimethylamino)-5-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122029595 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[2-(dimethylamino)-5-(trifluoromethyl)anilino]cyclohexane-1-carboxylic acid |
| SMILES | CN(C)c1ccc(C(F)(F)F)cc1NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H21F3N2O2/c1-21(2)14-8-5-11(16(17,18)19)9-13(14)20-12-6-3-10(4-7-12)15(22)23/h5,8-10,12,20H,3-4,6-7H2,1-2H3,(H,22,23) |
| InChIKey | LZSLJTUSBROUGR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |