C12H11ClF3NO — CID 110604257
N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylcyclopropanecarboxamide (PubChem CID 110604257) has the molecular formula C12H11ClF3NO and a molecular weight of 277.67 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylcyclopropanecarboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 110604257 |
| Molecular Formula | C12H11ClF3NO |
| Molecular Weight | 277.67 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylcyclopropanecarboxamide |
| SMILES | CN(C(=O)C1CC1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H11ClF3NO/c1-17(11(18)7-2-3-7)10-6-8(12(14,15)16)4-5-9(10)13/h4-7H,2-3H2,1H3 |
| InChIKey | LEVXBYYDTGLHKY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |