C16H13ClF3NO3S — CID 110604269
4-acetyl-N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylbenzenesulfonamide (PubChem CID 110604269) has the molecular formula C16H13ClF3NO3S and a molecular weight of 391.80 g/mol. Its IUPAC name is 4-acetyl-N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-acetyl-N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110604269 |
| Molecular Formula | C16H13ClF3NO3S |
| Molecular Weight | 391.80 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 4-acetyl-N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylbenzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N(C)c2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H13ClF3NO3S/c1-10(22)11-3-6-13(7-4-11)25(23,24)21(2)15-9-12(16(18,19)20)5-8-14(15)17/h3-9H,1-2H3 |
| InChIKey | OEUGDGVQYHZPQP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |