C11H14ClF3N2O2S — CID 110613248
1-chloro-2-[methyl(propylsulfamoyl)amino]-4-(trifluoromethyl)benzene (PubChem CID 110613248) has the molecular formula C11H14ClF3N2O2S and a molecular weight of 330.76 g/mol. Its IUPAC name is 1-chloro-2-[methyl(propylsulfamoyl)amino]-4-(trifluoromethyl)benzene.
| Compound Name | 1-chloro-2-[methyl(propylsulfamoyl)amino]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 110613248 |
| Molecular Formula | C11H14ClF3N2O2S |
| Molecular Weight | 330.76 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-chloro-2-[methyl(propylsulfamoyl)amino]-4-(trifluoromethyl)benzene |
| SMILES | CCCNS(=O)(=O)N(C)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H14ClF3N2O2S/c1-3-6-16-20(18,19)17(2)10-7-8(11(13,14)15)4-5-9(10)12/h4-5,7,16H,3,6H2,1-2H3 |
| InChIKey | QEJRCLDNHKHJJH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.76 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |