C11H13ClF3NO2S — CID 110604267
N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylpropane-1-sulfonamide (PubChem CID 110604267) has the molecular formula C11H13ClF3NO2S and a molecular weight of 315.74 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylpropane-1-sulfonamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 110604267 |
| Molecular Formula | C11H13ClF3NO2S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N-methylpropane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)N(C)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H13ClF3NO2S/c1-3-6-19(17,18)16(2)10-7-8(11(13,14)15)4-5-9(10)12/h4-5,7H,3,6H2,1-2H3 |
| InChIKey | UNTDSOQHQGYERS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |