C11H10ClF3N2O2S — CID 15616020
1-[2-chloro-5-(trifluoromethyl)phenyl]-N-(cyanomethyl)-N-methylmethanesulfonamide (PubChem CID 15616020) has the molecular formula C11H10ClF3N2O2S and a molecular weight of 326.73 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-N-(cyanomethyl)-N-methylmethanesulfonamide.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-N-(cyanomethyl)-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 15616020 |
| Molecular Formula | C11H10ClF3N2O2S |
| Molecular Weight | 326.73 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-N-(cyanomethyl)-N-methylmethanesulfonamide |
| SMILES | CN(CC#N)S(=O)(=O)Cc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H10ClF3N2O2S/c1-17(5-4-16)20(18,19)7-8-6-9(11(13,14)15)2-3-10(8)12/h2-3,6H,5,7H2,1H3 |
| InChIKey | FXMIBMJFOHCFQD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|