C8H5ClF3O3S- — CID 59623726
[2-chloro-5-(trifluoromethyl)phenyl]methanesulfonate (PubChem CID 59623726) has the molecular formula C8H5ClF3O3S- and a molecular weight of 273.64 g/mol. Its IUPAC name is [2-chloro-5-(trifluoromethyl)phenyl]methanesulfonate.
| Compound Name | [2-chloro-5-(trifluoromethyl)phenyl]methanesulfonate |
|---|---|
| PubChem CID | 59623726 |
| Molecular Formula | C8H5ClF3O3S- |
| Molecular Weight | 273.64 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | [2-chloro-5-(trifluoromethyl)phenyl]methanesulfonate |
| SMILES | O=S(=O)([O-])Cc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C8H6ClF3O3S/c9-7-2-1-6(8(10,11)12)3-5(7)4-16(13,14)15/h1-3H,4H2,(H,13,14,15)/p-1 |
| InChIKey | FWSACBCHRXOLRY-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|