C9H8ClF3N2 — CID 91755508
2-[2-chloro-5-(trifluoromethyl)phenyl]ethanimidamide (PubChem CID 91755508) has the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)phenyl]ethanimidamide.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 91755508 |
| Molecular Formula | C9H8ClF3N2 |
| Molecular Weight | 236.62 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]ethanimidamide |
| SMILES | [H]/N=C(\N)Cc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C9H8ClF3N2/c10-7-2-1-6(9(11,12)13)3-5(7)4-8(14)15/h1-3H,4H2,(H3,14,15) |
| InChIKey | GNOASTZDYABDEI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.62 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|