C12H13ClF3N3O2 — CID 161150838
acetic acid;2-[[2-chloro-5-(trifluoromethyl)phenyl]methylideneamino]ethanimidamide (PubChem CID 161150838) has the molecular formula C12H13ClF3N3O2 and a molecular weight of 323.70 g/mol. Its IUPAC name is acetic acid;2-[[2-chloro-5-(trifluoromethyl)phenyl]methylideneamino]ethanimidamide.
| Compound Name | acetic acid;2-[[2-chloro-5-(trifluoromethyl)phenyl]methylideneamino]ethanimidamide |
|---|---|
| PubChem CID | 161150838 |
| Molecular Formula | C12H13ClF3N3O2 |
| Molecular Weight | 323.70 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | acetic acid;2-[[2-chloro-5-(trifluoromethyl)phenyl]methylideneamino]ethanimidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)C/N=C/c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H9ClF3N3.C2H4O2/c11-8-2-1-7(10(12,13)14)3-6(8)4-17-5-9(15)16;1-2(3)4/h1-4H,5H2,(H3,15,16);1H3,(H,3,4)/b17-4+; |
| InChIKey | NTBMCZHTIJZPLT-DBYAPITPSA-N |
| XLogP | 2.80 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.70 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|