About 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide
2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide (PubChem CID 158087991) has the molecular formula C10H11Cl2N3O
and a molecular weight of 260.12 g/mol. Its IUPAC name is 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide.
Molecular Properties
| Compound Name | 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide |
| PubChem CID | 158087991 |
| Molecular Formula | C10H11Cl2N3O |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide |
| SMILES | [H]/N=C(\N)C/N=C/c1c(Cl)cc(OC)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O/c1-16-6-2-8(11)7(9(12)3-6)4-15-5-10(13)14/h2-4H,5H2,1H3,(H3,13,14)/b15-4+ |
| InChIKey | LLGINIFLKRCPNU-SYZQJQIISA-N |
| XLogP | 2.36 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide?
The IUPAC name of 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide (CID 158087991) is 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide.
What is the SMILES notation for 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide?
The canonical SMILES for 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide is [H]/N=C(\N)C/N=C/c1c(Cl)cc(OC)cc1Cl.
What is the InChIKey of 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide?
The InChIKey is LLGINIFLKRCPNU-SYZQJQIISA-N. The full InChI is InChI=1S/C10H11Cl2N3O/c1-16-6-2-8(11)7(9(12)3-6)4-15-5-10(13)14/h2-4H,5H2,1H3,(H3,13,14)/b15-4+.
What are the key properties of 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide?
2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide has a molecular weight of 260.12 g/mol, XLogP of 2.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichloro-4-methoxyphenyl)methylideneamino]ethanimidamide is sourced from PubChem (CID 158087991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).