C9H11N3O2 — CID 162009957
2-[(2,5-dihydroxyphenyl)methylideneamino]ethanimidamide (PubChem CID 162009957) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-[(2,5-dihydroxyphenyl)methylideneamino]ethanimidamide.
| Compound Name | 2-[(2,5-dihydroxyphenyl)methylideneamino]ethanimidamide |
|---|---|
| PubChem CID | 162009957 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-[(2,5-dihydroxyphenyl)methylideneamino]ethanimidamide |
| SMILES | [H]/N=C(\N)C/N=C/c1cc(O)ccc1O |
| InChI | InChI=1S/C9H11N3O2/c10-9(11)5-12-4-6-3-7(13)1-2-8(6)14/h1-4,13-14H,5H2,(H3,10,11)/b12-4+ |
| InChIKey | CCYXSTOQNHLOLT-UUILKARUSA-N |
| XLogP | 0.45 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|