C11H11BrN2O4 — CID 137090711
2-[[2-[(5-bromo-2-hydroxyphenyl)methylideneamino]acetyl]amino]acetic acid (PubChem CID 137090711) has the molecular formula C11H11BrN2O4 and a molecular weight of 315.12 g/mol. Its IUPAC name is 2-[[2-[(5-bromo-2-hydroxyphenyl)methylideneamino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[(5-bromo-2-hydroxyphenyl)methylideneamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 137090711 |
| Molecular Formula | C11H11BrN2O4 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 2-[[2-[(5-bromo-2-hydroxyphenyl)methylideneamino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C11H11BrN2O4/c12-8-1-2-9(15)7(3-8)4-13-5-10(16)14-6-11(17)18/h1-4,15H,5-6H2,(H,14,16)(H,17,18)/b13-4+ |
| InChIKey | VVVLSWYZCFVRNX-YIXHJXPBSA-N |
| XLogP | 0.77 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|