C16H13Br2N3O3 — CID 136720747
2-bromo-N-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 136720747) has the molecular formula C16H13Br2N3O3 and a molecular weight of 455.11 g/mol. Its IUPAC name is 2-bromo-N-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2-bromo-N-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 136720747 |
| Molecular Formula | C16H13Br2N3O3 |
| Molecular Weight | 455.11 g/mol |
| Exact Mass | 452.93 |
| IUPAC Name | 2-bromo-N-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Br)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C16H13Br2N3O3/c17-11-5-6-14(22)10(7-11)8-20-21-15(23)9-19-16(24)12-3-1-2-4-13(12)18/h1-8,22H,9H2,(H,19,24)(H,21,23)/b20-8- |
| InChIKey | BDVCNHRQXOCTHH-ZBKNUEDVSA-N |
| XLogP | 2.80 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.11 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|