C18H13BrClN3O3S — CID 136905655
N-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 136905655) has the molecular formula C18H13BrClN3O3S and a molecular weight of 466.74 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 136905655 |
| Molecular Formula | C18H13BrClN3O3S |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 464.95 |
| IUPAC Name | N-[2-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1sc2ccccc2c1Cl)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C18H13BrClN3O3S/c19-11-5-6-13(24)10(7-11)8-22-23-15(25)9-21-18(26)17-16(20)12-3-1-2-4-14(12)27-17/h1-8,24H,9H2,(H,21,26)(H,23,25)/b22-8- |
| InChIKey | UBUKMVUEFWNQGJ-UYOCIXKTSA-N |
| XLogP | 3.90 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|