C21H14Cl2N4O2S — CID 4119566
3-chloro-N-[2-[2-[(2-chloroquinolin-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide (PubChem CID 4119566) has the molecular formula C21H14Cl2N4O2S and a molecular weight of 457.34 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-[(2-chloroquinolin-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-[2-[(2-chloroquinolin-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4119566 |
| Molecular Formula | C21H14Cl2N4O2S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 3-chloro-N-[2-[2-[(2-chloroquinolin-3-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1sc2ccccc2c1Cl)NN=Cc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C21H14Cl2N4O2S/c22-18-14-6-2-4-8-16(14)30-19(18)21(29)24-11-17(28)27-25-10-13-9-12-5-1-3-7-15(12)26-20(13)23/h1-10H,11H2,(H,24,29)(H,27,28) |
| InChIKey | FAETUZAPTVAHRQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|