C22H17ClN4O — CID 6897391
N-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide (PubChem CID 6897391) has the molecular formula C22H17ClN4O and a molecular weight of 388.86 g/mol. Its IUPAC name is N-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide.
| Compound Name | N-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
|---|---|
| PubChem CID | 6897391 |
| Molecular Formula | C22H17ClN4O |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-2-(naphthalen-2-ylamino)acetamide |
| SMILES | O=C(CNc1ccc2ccccc2c1)N/N=C/c1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C22H17ClN4O/c23-22-18(11-17-7-3-4-8-20(17)26-22)13-25-27-21(28)14-24-19-10-9-15-5-1-2-6-16(15)12-19/h1-13,24H,14H2,(H,27,28)/b25-13+ |
| InChIKey | LQJZSQNIRIQIHA-DHRITJCHSA-N |
| XLogP | 4.60 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|