C21H20ClN3O2 — CID 6028352
N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]-2-(4-propylphenoxy)acetamide (PubChem CID 6028352) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]-2-(4-propylphenoxy)acetamide.
| Compound Name | N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]-2-(4-propylphenoxy)acetamide |
|---|---|
| PubChem CID | 6028352 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[(Z)-(2-chloroquinolin-3-yl)methylideneamino]-2-(4-propylphenoxy)acetamide |
| SMILES | CCCc1ccc(OCC(=O)N/N=C\c2cc3ccccc3nc2Cl)cc1 |
| InChI | InChI=1S/C21H20ClN3O2/c1-2-5-15-8-10-18(11-9-15)27-14-20(26)25-23-13-17-12-16-6-3-4-7-19(16)24-21(17)22/h3-4,6-13H,2,5,14H2,1H3,(H,25,26)/b23-13- |
| InChIKey | MHXFTJFECQVAEO-QRVIBDJDSA-N |
| XLogP | 4.37 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|