C19H15ClFN3O3 — CID 9317040
N-[(Z)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-2-(2-fluorophenoxy)acetamide (PubChem CID 9317040) has the molecular formula C19H15ClFN3O3 and a molecular weight of 387.80 g/mol. Its IUPAC name is N-[(Z)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-2-(2-fluorophenoxy)acetamide.
| Compound Name | N-[(Z)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-2-(2-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 9317040 |
| Molecular Formula | C19H15ClFN3O3 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-[(Z)-(2-chloro-6-methoxyquinolin-3-yl)methylideneamino]-2-(2-fluorophenoxy)acetamide |
| SMILES | COc1ccc2nc(Cl)c(/C=N\NC(=O)COc3ccccc3F)cc2c1 |
| InChI | InChI=1S/C19H15ClFN3O3/c1-26-14-6-7-16-12(9-14)8-13(19(20)23-16)10-22-24-18(25)11-27-17-5-3-2-4-15(17)21/h2-10H,11H2,1H3,(H,24,25)/b22-10- |
| InChIKey | QWMOEMAJDPXJRV-YVNNLAQVSA-N |
| XLogP | 3.57 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|