C19H15ClN4O3 — CID 51061370
N'-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-N-(4-methoxyphenyl)oxamide (PubChem CID 51061370) has the molecular formula C19H15ClN4O3 and a molecular weight of 382.81 g/mol. Its IUPAC name is N'-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-N-(4-methoxyphenyl)oxamide.
| Compound Name | N'-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-N-(4-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 51061370 |
| Molecular Formula | C19H15ClN4O3 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N'-[(E)-(2-chloroquinolin-3-yl)methylideneamino]-N-(4-methoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C/c2cc3ccccc3nc2Cl)cc1 |
| InChI | InChI=1S/C19H15ClN4O3/c1-27-15-8-6-14(7-9-15)22-18(25)19(26)24-21-11-13-10-12-4-2-3-5-16(12)23-17(13)20/h2-11H,1H3,(H,22,25)(H,24,26)/b21-11+ |
| InChIKey | OQQSRWXOEDBGKJ-SRZZPIQSSA-N |
| XLogP | 2.99 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|