C16H14N4O5 — CID 19660912
N-(4-methoxyphenyl)-N'-[(E)-(2-nitrophenyl)methylideneamino]oxamide (PubChem CID 19660912) has the molecular formula C16H14N4O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N'-[(E)-(2-nitrophenyl)methylideneamino]oxamide.
| Compound Name | N-(4-methoxyphenyl)-N'-[(E)-(2-nitrophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 19660912 |
| Molecular Formula | C16H14N4O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-(4-methoxyphenyl)-N'-[(E)-(2-nitrophenyl)methylideneamino]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C/c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14N4O5/c1-25-13-8-6-12(7-9-13)18-15(21)16(22)19-17-10-11-4-2-3-5-14(11)20(23)24/h2-10H,1H3,(H,18,21)(H,19,22)/b17-10+ |
| InChIKey | YDDPEXODLFIDLR-LICLKQGHSA-N |
| XLogP | 1.69 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|