C16H10ClF3N4O4 — CID 6249380
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(Z)-(2-nitrophenyl)methylideneamino]oxamide (PubChem CID 6249380) has the molecular formula C16H10ClF3N4O4 and a molecular weight of 414.73 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(Z)-(2-nitrophenyl)methylideneamino]oxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(Z)-(2-nitrophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6249380 |
| Molecular Formula | C16H10ClF3N4O4 |
| Molecular Weight | 414.73 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-[(Z)-(2-nitrophenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccccc1[N+](=O)[O-])C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10ClF3N4O4/c17-12-6-5-10(7-11(12)16(18,19)20)22-14(25)15(26)23-21-8-9-3-1-2-4-13(9)24(27)28/h1-8H,(H,22,25)(H,23,26)/b21-8- |
| InChIKey | WSUUOWBGHJWVPA-WNFQYIGGSA-N |
| XLogP | 3.36 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|