C16H11ClF3N3O2 — CID 6079733
N-(4-chlorophenyl)-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide (PubChem CID 6079733) has the molecular formula C16H11ClF3N3O2 and a molecular weight of 369.73 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide.
| Compound Name | N-(4-chlorophenyl)-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 6079733 |
| Molecular Formula | C16H11ClF3N3O2 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-(4-chlorophenyl)-N'-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccccc1C(F)(F)F)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClF3N3O2/c17-11-5-7-12(8-6-11)22-14(24)15(25)23-21-9-10-3-1-2-4-13(10)16(18,19)20/h1-9H,(H,22,24)(H,23,25)/b21-9- |
| InChIKey | NHFRXYZKOAFVAV-NKVSQWTQSA-N |
| XLogP | 3.45 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|