C22H16Cl2N4O3 — CID 6161305
N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(Z)-(2-chlorophenyl)methylideneamino]oxamide (PubChem CID 6161305) has the molecular formula C22H16Cl2N4O3 and a molecular weight of 455.30 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(Z)-(2-chlorophenyl)methylideneamino]oxamide.
| Compound Name | N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(Z)-(2-chlorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6161305 |
| Molecular Formula | C22H16Cl2N4O3 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | N-[2-[(4-chlorophenyl)carbamoyl]phenyl]-N'-[(Z)-(2-chlorophenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccccc1Cl)C(=O)Nc1ccccc1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16Cl2N4O3/c23-15-9-11-16(12-10-15)26-20(29)17-6-2-4-8-19(17)27-21(30)22(31)28-25-13-14-5-1-3-7-18(14)24/h1-13H,(H,26,29)(H,27,30)(H,28,31)/b25-13- |
| InChIKey | FNDGUNVLIJHBOM-MXAYSNPKSA-N |
| XLogP | 4.33 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|