C23H18Cl2N4O3 — CID 6028561
N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-[2-[(3-methylphenyl)carbamoyl]phenyl]oxamide (PubChem CID 6028561) has the molecular formula C23H18Cl2N4O3 and a molecular weight of 469.33 g/mol. Its IUPAC name is N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-[2-[(3-methylphenyl)carbamoyl]phenyl]oxamide.
| Compound Name | N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-[2-[(3-methylphenyl)carbamoyl]phenyl]oxamide |
|---|---|
| PubChem CID | 6028561 |
| Molecular Formula | C23H18Cl2N4O3 |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N'-[(Z)-(2,6-dichlorophenyl)methylideneamino]-N-[2-[(3-methylphenyl)carbamoyl]phenyl]oxamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)C(=O)N/N=C\c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C23H18Cl2N4O3/c1-14-6-4-7-15(12-14)27-21(30)16-8-2-3-11-20(16)28-22(31)23(32)29-26-13-17-18(24)9-5-10-19(17)25/h2-13H,1H3,(H,27,30)(H,28,31)(H,29,32)/b26-13- |
| InChIKey | LBAKWSPNHZNMDS-ZMFRSBBQSA-N |
| XLogP | 4.64 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|