C23H20N4O3 — CID 5060623
N'-(benzylideneamino)-N-[2-[(3-methylphenyl)carbamoyl]phenyl]oxamide (PubChem CID 5060623) has the molecular formula C23H20N4O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is N'-(benzylideneamino)-N-[2-[(3-methylphenyl)carbamoyl]phenyl]oxamide.
| Compound Name | N'-(benzylideneamino)-N-[2-[(3-methylphenyl)carbamoyl]phenyl]oxamide |
|---|---|
| PubChem CID | 5060623 |
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N'-(benzylideneamino)-N-[2-[(3-methylphenyl)carbamoyl]phenyl]oxamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)C(=O)NN=Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H20N4O3/c1-16-8-7-11-18(14-16)25-21(28)19-12-5-6-13-20(19)26-22(29)23(30)27-24-15-17-9-3-2-4-10-17/h2-15H,1H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | SHWUTLZGZVSHBE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|