C32H25BrN4O5 — CID 6173927
[4-bromo-2-[(Z)-[[2-[2-[(3-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 6173927) has the molecular formula C32H25BrN4O5 and a molecular weight of 625.48 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[2-[2-[(3-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-bromo-2-[(Z)-[[2-[2-[(3-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6173927 |
| Molecular Formula | C32H25BrN4O5 |
| Molecular Weight | 625.48 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | [4-bromo-2-[(Z)-[[2-[2-[(3-methylphenyl)carbamoyl]anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)C(=O)N/N=C\c2cc(Br)ccc2OC(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C32H25BrN4O5/c1-21-8-7-11-25(18-21)35-30(39)26-12-5-6-13-27(26)36-31(40)32(41)37-34-20-23-19-24(33)15-16-28(23)42-29(38)17-14-22-9-3-2-4-10-22/h2-20H,1H3,(H,35,39)(H,36,40)(H,37,41)/b17-14+,34-20- |
| InChIKey | VJFQEXBHUOXGPZ-MUZUFBTBSA-N |
| XLogP | 5.72 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|