C21H18N4O3S — CID 6022812
N-[2-[(3-methylphenyl)carbamoyl]phenyl]-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide (PubChem CID 6022812) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is N-[2-[(3-methylphenyl)carbamoyl]phenyl]-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide.
| Compound Name | N-[2-[(3-methylphenyl)carbamoyl]phenyl]-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide |
|---|---|
| PubChem CID | 6022812 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[2-[(3-methylphenyl)carbamoyl]phenyl]-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)C(=O)N/N=C\c2cccs2)c1 |
| InChI | InChI=1S/C21H18N4O3S/c1-14-6-4-7-15(12-14)23-19(26)17-9-2-3-10-18(17)24-20(27)21(28)25-22-13-16-8-5-11-29-16/h2-13H,1H3,(H,23,26)(H,24,27)(H,25,28)/b22-13- |
| InChIKey | KQRRTLCTLCGPEV-XKZIYDEJSA-N |
| XLogP | 3.40 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|