C17H13N3O2S — CID 5373375
N-naphthalen-1-yl-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide (PubChem CID 5373375) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is N-naphthalen-1-yl-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide.
| Compound Name | N-naphthalen-1-yl-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide |
|---|---|
| PubChem CID | 5373375 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-naphthalen-1-yl-N'-[(Z)-thiophen-2-ylmethylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1cccs1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C17H13N3O2S/c21-16(17(22)20-18-11-13-7-4-10-23-13)19-15-9-3-6-12-5-1-2-8-14(12)15/h1-11H,(H,19,21)(H,20,22)/b18-11- |
| InChIKey | RRMJEUKVCOVMFV-WQRHYEAKSA-N |
| XLogP | 2.99 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|