C19H14FN3O2 — CID 45055016
N'-[(E)-(3-fluorophenyl)methylideneamino]-N-naphthalen-1-yloxamide (PubChem CID 45055016) has the molecular formula C19H14FN3O2 and a molecular weight of 335.34 g/mol. Its IUPAC name is N'-[(E)-(3-fluorophenyl)methylideneamino]-N-naphthalen-1-yloxamide.
| Compound Name | N'-[(E)-(3-fluorophenyl)methylideneamino]-N-naphthalen-1-yloxamide |
|---|---|
| PubChem CID | 45055016 |
| Molecular Formula | C19H14FN3O2 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N'-[(E)-(3-fluorophenyl)methylideneamino]-N-naphthalen-1-yloxamide |
| SMILES | O=C(N/N=C/c1cccc(F)c1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H14FN3O2/c20-15-8-3-5-13(11-15)12-21-23-19(25)18(24)22-17-10-4-7-14-6-1-2-9-16(14)17/h1-12H,(H,22,24)(H,23,25)/b21-12+ |
| InChIKey | XPZYMQJSGLLPAP-CIAFOILYSA-N |
| XLogP | 3.07 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|