C17H16FN3O2 — CID 4642668
N-(2-ethylphenyl)-N'-[(4-fluorophenyl)methylideneamino]oxamide (PubChem CID 4642668) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is N-(2-ethylphenyl)-N'-[(4-fluorophenyl)methylideneamino]oxamide.
| Compound Name | N-(2-ethylphenyl)-N'-[(4-fluorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4642668 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-(2-ethylphenyl)-N'-[(4-fluorophenyl)methylideneamino]oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)NN=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3O2/c1-2-13-5-3-4-6-15(13)20-16(22)17(23)21-19-11-12-7-9-14(18)10-8-12/h3-11H,2H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | HEYSXACXAHOSIE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|