C18H19N3O2 — CID 8898860
N-(2-ethylphenyl)-N'-[(Z)-(2-methylphenyl)methylideneamino]oxamide (PubChem CID 8898860) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(2-ethylphenyl)-N'-[(Z)-(2-methylphenyl)methylideneamino]oxamide.
| Compound Name | N-(2-ethylphenyl)-N'-[(Z)-(2-methylphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 8898860 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-(2-ethylphenyl)-N'-[(Z)-(2-methylphenyl)methylideneamino]oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)N/N=C\c1ccccc1C |
| InChI | InChI=1S/C18H19N3O2/c1-3-14-9-6-7-11-16(14)20-17(22)18(23)21-19-12-15-10-5-4-8-13(15)2/h4-12H,3H2,1-2H3,(H,20,22)(H,21,23)/b19-12- |
| InChIKey | KAHHHWGVEHSUCQ-UNOMPAQXSA-N |
| XLogP | 2.65 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|