C16H17N3O2S — CID 19659662
N-(2-ethylphenyl)-N'-[(E)-(3-methylthiophen-2-yl)methylideneamino]oxamide (PubChem CID 19659662) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-(2-ethylphenyl)-N'-[(E)-(3-methylthiophen-2-yl)methylideneamino]oxamide.
| Compound Name | N-(2-ethylphenyl)-N'-[(E)-(3-methylthiophen-2-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 19659662 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-(2-ethylphenyl)-N'-[(E)-(3-methylthiophen-2-yl)methylideneamino]oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)N/N=C/c1sccc1C |
| InChI | InChI=1S/C16H17N3O2S/c1-3-12-6-4-5-7-13(12)18-15(20)16(21)19-17-10-14-11(2)8-9-22-14/h4-10H,3H2,1-2H3,(H,18,20)(H,19,21)/b17-10+ |
| InChIKey | PDMZOUWIILKJAR-LICLKQGHSA-N |
| XLogP | 2.71 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|