C12H17N3O2S — CID 94846890
N',N'-diethyl-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]oxamide (PubChem CID 94846890) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N',N'-diethyl-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]oxamide.
| Compound Name | N',N'-diethyl-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 94846890 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N',N'-diethyl-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]oxamide |
| SMILES | CCN(CC)C(=O)C(=O)N/N=C\c1sccc1C |
| InChI | InChI=1S/C12H17N3O2S/c1-4-15(5-2)12(17)11(16)14-13-8-10-9(3)6-7-18-10/h6-8H,4-5H2,1-3H3,(H,14,16)/b13-8- |
| InChIKey | DAYGAIXURKRIKM-JYRVWZFOSA-N |
| XLogP | 1.38 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|