C11H16N2OS — CID 3481612
3-methyl-N-[(3-methylthiophen-2-yl)methylideneamino]butanamide (PubChem CID 3481612) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 3-methyl-N-[(3-methylthiophen-2-yl)methylideneamino]butanamide.
| Compound Name | 3-methyl-N-[(3-methylthiophen-2-yl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 3481612 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-methyl-N-[(3-methylthiophen-2-yl)methylideneamino]butanamide |
| SMILES | Cc1ccsc1C=NNC(=O)CC(C)C |
| InChI | InChI=1S/C11H16N2OS/c1-8(2)6-11(14)13-12-7-10-9(3)4-5-15-10/h4-5,7-8H,6H2,1-3H3,(H,13,14) |
| InChIKey | VNLXGPIKHUWLQC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|