C16H18N4O2S2 — CID 6385345
N,N'-bis[(Z)-(3-methylthiophen-2-yl)methylideneamino]butanediamide (PubChem CID 6385345) has the molecular formula C16H18N4O2S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is N,N'-bis[(Z)-(3-methylthiophen-2-yl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(Z)-(3-methylthiophen-2-yl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 6385345 |
| Molecular Formula | C16H18N4O2S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N,N'-bis[(Z)-(3-methylthiophen-2-yl)methylideneamino]butanediamide |
| SMILES | Cc1ccsc1/C=N\NC(=O)CCC(=O)N/N=C\c1sccc1C |
| InChI | InChI=1S/C16H18N4O2S2/c1-11-5-7-23-13(11)9-17-19-15(21)3-4-16(22)20-18-10-14-12(2)6-8-24-14/h5-10H,3-4H2,1-2H3,(H,19,21)(H,20,22)/b17-9-,18-10- |
| InChIKey | HDGBYJCDWQXQQB-XFQWXJFMSA-N |
| XLogP | 2.81 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|