C10H10FN3O2 — CID 94844116
N'-[(Z)-(4-fluorophenyl)methylideneamino]-N-methyloxamide (PubChem CID 94844116) has the molecular formula C10H10FN3O2 and a molecular weight of 223.21 g/mol. Its IUPAC name is N'-[(Z)-(4-fluorophenyl)methylideneamino]-N-methyloxamide.
| Compound Name | N'-[(Z)-(4-fluorophenyl)methylideneamino]-N-methyloxamide |
|---|---|
| PubChem CID | 94844116 |
| Molecular Formula | C10H10FN3O2 |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N'-[(Z)-(4-fluorophenyl)methylideneamino]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)N/N=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FN3O2/c1-12-9(15)10(16)14-13-6-7-2-4-8(11)5-3-7/h2-6H,1H3,(H,12,15)(H,14,16)/b13-6- |
| InChIKey | NYGNCKUAVCOXGA-MLPAPPSSSA-N |
| XLogP | 0.02 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|