About N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide
N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide (PubChem CID 6019949) has the molecular formula C14H11FN4O2
and a molecular weight of 286.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide |
| PubChem CID | 6019949 |
| Molecular Formula | C14H11FN4O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccncc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H11FN4O2/c15-11-1-3-12(4-2-11)18-13(20)14(21)19-17-9-10-5-7-16-8-6-10/h1-9H,(H,18,20)(H,19,21)/b17-9- |
| InChIKey | CVIQCAPJZGBUJM-MFOYZWKCSA-N |
| XLogP | 1.31 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide?
The IUPAC name of N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide (CID 6019949) is N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide.
What is the SMILES notation for N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide?
The canonical SMILES for N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide is O=C(N/N=C\c1ccncc1)C(=O)Nc1ccc(F)cc1.
What is the InChIKey of N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide?
The InChIKey is CVIQCAPJZGBUJM-MFOYZWKCSA-N. The full InChI is InChI=1S/C14H11FN4O2/c15-11-1-3-12(4-2-11)18-13(20)14(21)19-17-9-10-5-7-16-8-6-10/h1-9H,(H,18,20)(H,19,21)/b17-9-.
What are the key properties of N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide?
N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide has a molecular weight of 286.27 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-N'-[(Z)-pyridin-4-ylmethylideneamino]oxamide is sourced from PubChem (CID 6019949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).