About [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate
[(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate (PubChem CID 88512822) has the molecular formula C7H9N3O3
and a molecular weight of 183.17 g/mol. Its IUPAC name is [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate.
Molecular Properties
| Compound Name | [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate |
| PubChem CID | 88512822 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate |
| SMILES | O.O=C(O)N/N=C/c1ccncc1 |
| InChI | InChI=1S/C7H7N3O2.H2O/c11-7(12)10-9-5-6-1-3-8-4-2-6;/h1-5,10H,(H,11,12);1H2/b9-5+; |
| InChIKey | ZVBFCMHCGWIPGK-SZKNIZGXSA-N |
| XLogP | -0.14 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate?
The IUPAC name of [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate (CID 88512822) is [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate.
What is the SMILES notation for [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate?
The canonical SMILES for [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate is O.O=C(O)N/N=C/c1ccncc1.
What is the InChIKey of [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate?
The InChIKey is ZVBFCMHCGWIPGK-SZKNIZGXSA-N. The full InChI is InChI=1S/C7H7N3O2.H2O/c11-7(12)10-9-5-6-1-3-8-4-2-6;/h1-5,10H,(H,11,12);1H2/b9-5+;.
What are the key properties of [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate?
[(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate has a molecular weight of 183.17 g/mol, XLogP of -0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-pyridin-4-ylmethylideneamino]carbamic acid;hydrate is sourced from PubChem (CID 88512822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).