C15H11FN4O4 — CID 4187128
N-(4-fluorophenyl)-N'-[(4-nitrophenyl)methylideneamino]oxamide (PubChem CID 4187128) has the molecular formula C15H11FN4O4 and a molecular weight of 330.28 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-[(4-nitrophenyl)methylideneamino]oxamide.
| Compound Name | N-(4-fluorophenyl)-N'-[(4-nitrophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4187128 |
| Molecular Formula | C15H11FN4O4 |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-(4-fluorophenyl)-N'-[(4-nitrophenyl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H11FN4O4/c16-11-3-5-12(6-4-11)18-14(21)15(22)19-17-9-10-1-7-13(8-2-10)20(23)24/h1-9H,(H,18,21)(H,19,22) |
| InChIKey | NJINAUVDSZEDHH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|