C16H12N6O6 — CID 6163815
N,N'-bis[(Z)-(4-nitrophenyl)methylideneamino]oxamide (PubChem CID 6163815) has the molecular formula C16H12N6O6 and a molecular weight of 384.31 g/mol. Its IUPAC name is N,N'-bis[(Z)-(4-nitrophenyl)methylideneamino]oxamide.
| Compound Name | N,N'-bis[(Z)-(4-nitrophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6163815 |
| Molecular Formula | C16H12N6O6 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N,N'-bis[(Z)-(4-nitrophenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccc([N+](=O)[O-])cc1)C(=O)N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12N6O6/c23-15(19-17-9-11-1-5-13(6-2-11)21(25)26)16(24)20-18-10-12-3-7-14(8-4-12)22(27)28/h1-10H,(H,19,23)(H,20,24)/b17-9-,18-10- |
| InChIKey | ZQUUQVPOSAMAQO-XFQWXJFMSA-N |
| XLogP | 1.10 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|