C16H13ClN4O4 — CID 6030367
N-(3-chloro-2-methylphenyl)-N'-[(Z)-(4-nitrophenyl)methylideneamino]oxamide (PubChem CID 6030367) has the molecular formula C16H13ClN4O4 and a molecular weight of 360.76 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-[(Z)-(4-nitrophenyl)methylideneamino]oxamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-(4-nitrophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 6030367 |
| Molecular Formula | C16H13ClN4O4 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-(4-nitrophenyl)methylideneamino]oxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(=O)N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H13ClN4O4/c1-10-13(17)3-2-4-14(10)19-15(22)16(23)20-18-9-11-5-7-12(8-6-11)21(24)25/h2-9H,1H3,(H,19,22)(H,20,23)/b18-9- |
| InChIKey | NFLLDJNCSPCFOH-NVMNQCDNSA-N |
| XLogP | 2.65 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|