C15H10Cl2N4O5 — CID 135813992
N-(2,3-dichlorophenyl)-N'-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]oxamide (PubChem CID 135813992) has the molecular formula C15H10Cl2N4O5 and a molecular weight of 397.17 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]oxamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 135813992 |
| Molecular Formula | C15H10Cl2N4O5 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1ccc(O)c([N+](=O)[O-])c1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H10Cl2N4O5/c16-9-2-1-3-10(13(9)17)19-14(23)15(24)20-18-7-8-4-5-12(22)11(6-8)21(25)26/h1-7,22H,(H,19,23)(H,20,24)/b18-7- |
| InChIKey | OCHRVTQAPKQPCT-WSVATBPTSA-N |
| XLogP | 2.70 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|