C14H8Cl3N3O4 — CID 108500702
N-(4-chloro-3-nitrophenyl)-N'-(2,3-dichlorophenyl)oxamide (PubChem CID 108500702) has the molecular formula C14H8Cl3N3O4 and a molecular weight of 388.59 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-N'-(2,3-dichlorophenyl)oxamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-N'-(2,3-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 108500702 |
| Molecular Formula | C14H8Cl3N3O4 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-N'-(2,3-dichlorophenyl)oxamide |
| SMILES | O=C(Nc1ccc(Cl)c([N+](=O)[O-])c1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H8Cl3N3O4/c15-8-5-4-7(6-11(8)20(23)24)18-13(21)14(22)19-10-3-1-2-9(16)12(10)17/h1-6H,(H,18,21)(H,19,22) |
| InChIKey | CWMSSLLHHSXFJB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|