C12H14ClN3O4 — CID 108506810
N'-tert-butyl-N-(4-chloro-3-nitrophenyl)oxamide (PubChem CID 108506810) has the molecular formula C12H14ClN3O4 and a molecular weight of 299.71 g/mol. Its IUPAC name is N'-tert-butyl-N-(4-chloro-3-nitrophenyl)oxamide.
| Compound Name | N'-tert-butyl-N-(4-chloro-3-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 108506810 |
| Molecular Formula | C12H14ClN3O4 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N'-tert-butyl-N-(4-chloro-3-nitrophenyl)oxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14ClN3O4/c1-12(2,3)15-11(18)10(17)14-7-4-5-8(13)9(6-7)16(19)20/h4-6H,1-3H3,(H,14,17)(H,15,18) |
| InChIKey | IBJMQRMJWXNOFL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|