C12H14ClN3O6 — CID 108512803
N'-(4-chloro-3-nitrophenyl)-N-(2,2-dimethoxyethyl)oxamide (PubChem CID 108512803) has the molecular formula C12H14ClN3O6 and a molecular weight of 331.71 g/mol. Its IUPAC name is N'-(4-chloro-3-nitrophenyl)-N-(2,2-dimethoxyethyl)oxamide.
| Compound Name | N'-(4-chloro-3-nitrophenyl)-N-(2,2-dimethoxyethyl)oxamide |
|---|---|
| PubChem CID | 108512803 |
| Molecular Formula | C12H14ClN3O6 |
| Molecular Weight | 331.71 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N'-(4-chloro-3-nitrophenyl)-N-(2,2-dimethoxyethyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1)OC |
| InChI | InChI=1S/C12H14ClN3O6/c1-21-10(22-2)6-14-11(17)12(18)15-7-3-4-8(13)9(5-7)16(19)20/h3-5,10H,6H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | ISWFJKVJIMSZBS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.71 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|