C16H12Cl2N4O6 — CID 3339507
N,N'-bis(4-chloro-3-nitrophenyl)butanediamide (PubChem CID 3339507) has the molecular formula C16H12Cl2N4O6 and a molecular weight of 427.20 g/mol. Its IUPAC name is N,N'-bis(4-chloro-3-nitrophenyl)butanediamide.
| Compound Name | N,N'-bis(4-chloro-3-nitrophenyl)butanediamide |
|---|---|
| PubChem CID | 3339507 |
| Molecular Formula | C16H12Cl2N4O6 |
| Molecular Weight | 427.20 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | N,N'-bis(4-chloro-3-nitrophenyl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12Cl2N4O6/c17-11-3-1-9(7-13(11)21(25)26)19-15(23)5-6-16(24)20-10-2-4-12(18)14(8-10)22(27)28/h1-4,7-8H,5-6H2,(H,19,23)(H,20,24) |
| InChIKey | OMWBPUSQSPOBJH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|