C22H24Cl2N4O6 — CID 17080083
N,N'-bis(4-chloro-3-nitrophenyl)decanediamide (PubChem CID 17080083) has the molecular formula C22H24Cl2N4O6 and a molecular weight of 511.36 g/mol. Its IUPAC name is N,N'-bis(4-chloro-3-nitrophenyl)decanediamide.
| Compound Name | N,N'-bis(4-chloro-3-nitrophenyl)decanediamide |
|---|---|
| PubChem CID | 17080083 |
| Molecular Formula | C22H24Cl2N4O6 |
| Molecular Weight | 511.36 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | N,N'-bis(4-chloro-3-nitrophenyl)decanediamide |
| SMILES | O=C(CCCCCCCCC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24Cl2N4O6/c23-17-11-9-15(13-19(17)27(31)32)25-21(29)7-5-3-1-2-4-6-8-22(30)26-16-10-12-18(24)20(14-16)28(33)34/h9-14H,1-8H2,(H,25,29)(H,26,30) |
| InChIKey | IYNKOYGWETUCFH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.36 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|