C17H14F2N4O6 — CID 4303961
N,N'-bis(4-fluoro-3-nitrophenyl)pentanediamide (PubChem CID 4303961) has the molecular formula C17H14F2N4O6 and a molecular weight of 408.32 g/mol. Its IUPAC name is N,N'-bis(4-fluoro-3-nitrophenyl)pentanediamide.
| Compound Name | N,N'-bis(4-fluoro-3-nitrophenyl)pentanediamide |
|---|---|
| PubChem CID | 4303961 |
| Molecular Formula | C17H14F2N4O6 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N,N'-bis(4-fluoro-3-nitrophenyl)pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1ccc(F)c([N+](=O)[O-])c1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14F2N4O6/c18-12-6-4-10(8-14(12)22(26)27)20-16(24)2-1-3-17(25)21-11-5-7-13(19)15(9-11)23(28)29/h4-9H,1-3H2,(H,20,24)(H,21,25) |
| InChIKey | AGZMMBQCAIHPQF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|