C14H18FN3O4 — CID 33172062
N-[3-(4-fluoro-3-nitroanilino)-3-oxopropyl]-2,2-dimethylpropanamide (PubChem CID 33172062) has the molecular formula C14H18FN3O4 and a molecular weight of 311.31 g/mol. Its IUPAC name is N-[3-(4-fluoro-3-nitroanilino)-3-oxopropyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-(4-fluoro-3-nitroanilino)-3-oxopropyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 33172062 |
| Molecular Formula | C14H18FN3O4 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[3-(4-fluoro-3-nitroanilino)-3-oxopropyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCC(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18FN3O4/c1-14(2,3)13(20)16-7-6-12(19)17-9-4-5-10(15)11(8-9)18(21)22/h4-5,8H,6-7H2,1-3H3,(H,16,20)(H,17,19) |
| InChIKey | GJZRTWHRJWNXSX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|